C12H17F3IN3O2 — CID 103150444
N-ethyl-5-iodo-6-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine (PubChem CID 103150444) has the molecular formula C12H17F3IN3O2 and a molecular weight of 419.19 g/mol. Its IUPAC name is N-ethyl-5-iodo-6-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-6-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103150444 |
| Molecular Formula | C12H17F3IN3O2 |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N-ethyl-5-iodo-6-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
| SMILES | CCNc1nc(CCOCC(F)(F)F)nc(COC)c1I |
| InChI | InChI=1S/C12H17F3IN3O2/c1-3-17-11-10(16)8(6-20-2)18-9(19-11)4-5-21-7-12(13,14)15/h3-7H2,1-2H3,(H,17,18,19) |
| InChIKey | UBIIJYCQZAPPSR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|