C14H25IN4O — CID 66302832
2-[2-(diethylamino)ethyl]-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 66302832) has the molecular formula C14H25IN4O and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl]-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 2-[2-(diethylamino)ethyl]-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66302832 |
| Molecular Formula | C14H25IN4O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[2-(diethylamino)ethyl]-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(CCN(CC)CC)nc(COC)c1I |
| InChI | InChI=1S/C14H25IN4O/c1-5-16-14-13(15)11(10-20-4)17-12(18-14)8-9-19(6-2)7-3/h5-10H2,1-4H3,(H,16,17,18) |
| InChIKey | UMRUUXMGZKJPBW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|