C13H17IN4OS — CID 66303037
N-ethyl-5-iodo-6-(methoxymethyl)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine (PubChem CID 66303037) has the molecular formula C13H17IN4OS and a molecular weight of 404.28 g/mol. Its IUPAC name is N-ethyl-5-iodo-6-(methoxymethyl)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-6-(methoxymethyl)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66303037 |
| Molecular Formula | C13H17IN4OS |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-ethyl-5-iodo-6-(methoxymethyl)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine |
| SMILES | CCNc1nc(Cc2nc(C)cs2)nc(COC)c1I |
| InChI | InChI=1S/C13H17IN4OS/c1-4-15-13-12(14)9(6-19-3)17-10(18-13)5-11-16-8(2)7-20-11/h7H,4-6H2,1-3H3,(H,15,17,18) |
| InChIKey | KGIRYMZULITUAY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|