C15H21IN4S — CID 66300150
5-iodo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propan-2-yl-N-propylpyrimidin-4-amine (PubChem CID 66300150) has the molecular formula C15H21IN4S and a molecular weight of 416.33 g/mol. Its IUPAC name is 5-iodo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propan-2-yl-N-propylpyrimidin-4-amine.
| Compound Name | 5-iodo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propan-2-yl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66300150 |
| Molecular Formula | C15H21IN4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 5-iodo-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-propan-2-yl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(Cc2nc(C)cs2)nc(C(C)C)c1I |
| InChI | InChI=1S/C15H21IN4S/c1-5-6-17-15-13(16)14(9(2)3)19-11(20-15)7-12-18-10(4)8-21-12/h8-9H,5-7H2,1-4H3,(H,17,19,20) |
| InChIKey | UXKWFSAATDTYID-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|