C16H21IN4 — CID 66299761
5-iodo-6-propan-2-yl-N-propyl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 66299761) has the molecular formula C16H21IN4 and a molecular weight of 396.28 g/mol. Its IUPAC name is 5-iodo-6-propan-2-yl-N-propyl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 5-iodo-6-propan-2-yl-N-propyl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66299761 |
| Molecular Formula | C16H21IN4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 5-iodo-6-propan-2-yl-N-propyl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | CCCNc1nc(Cc2ccccn2)nc(C(C)C)c1I |
| InChI | InChI=1S/C16H21IN4/c1-4-8-19-16-14(17)15(11(2)3)20-13(21-16)10-12-7-5-6-9-18-12/h5-7,9,11H,4,8,10H2,1-3H3,(H,19,20,21) |
| InChIKey | QJFCFDAVRZAPGR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|