C13H22IN3O2 — CID 116777004
N-ethyl-5-iodo-2-(2-methoxybutan-2-yl)-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 116777004) has the molecular formula C13H22IN3O2 and a molecular weight of 379.24 g/mol. Its IUPAC name is N-ethyl-5-iodo-2-(2-methoxybutan-2-yl)-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-2-(2-methoxybutan-2-yl)-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116777004 |
| Molecular Formula | C13H22IN3O2 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-ethyl-5-iodo-2-(2-methoxybutan-2-yl)-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(C(C)(CC)OC)nc(COC)c1I |
| InChI | InChI=1S/C13H22IN3O2/c1-6-13(3,19-5)12-16-9(8-18-4)10(14)11(17-12)15-7-2/h6-8H2,1-5H3,(H,15,16,17) |
| InChIKey | VCIKAXKAFSWJNL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|