C8H6ClF4IN2O — CID 103473589
4-chloro-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473589) has the molecular formula C8H6ClF4IN2O and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-chloro-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 4-chloro-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473589 |
| Molecular Formula | C8H6ClF4IN2O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | 4-chloro-5-iodo-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | FC(F)C(F)(F)COCc1ncc(I)c(Cl)n1 |
| InChI | InChI=1S/C8H6ClF4IN2O/c9-6-4(14)1-15-5(16-6)2-17-3-8(12,13)7(10)11/h1,7H,2-3H2 |
| InChIKey | QQIAYHAJJSHRMY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|