C12H13ClF4N2O — CID 103473539
4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydroquinazoline (PubChem CID 103473539) has the molecular formula C12H13ClF4N2O and a molecular weight of 312.69 g/mol. Its IUPAC name is 4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 103473539 |
| Molecular Formula | C12H13ClF4N2O |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-chloro-2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydroquinazoline |
| SMILES | FC(F)C(F)(F)COCc1nc(Cl)c2c(n1)CCCC2 |
| InChI | InChI=1S/C12H13ClF4N2O/c13-10-7-3-1-2-4-8(7)18-9(19-10)5-20-6-12(16,17)11(14)15/h11H,1-6H2 |
| InChIKey | IYBPPKPHIHHLGN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|