C13H19ClN2O2 — CID 102927204
4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline (PubChem CID 102927204) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 102927204 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydroquinazoline |
| SMILES | COCCOCCc1nc(Cl)c2c(n1)CCCC2 |
| InChI | InChI=1S/C13H19ClN2O2/c1-17-8-9-18-7-6-12-15-11-5-3-2-4-10(11)13(14)16-12/h2-9H2,1H3 |
| InChIKey | GODIJFAQZWPXNQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|