C11H17ClN2O2 — CID 102927201
4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrimidine (PubChem CID 102927201) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrimidine.
| Compound Name | 4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 102927201 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-chloro-2-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrimidine |
| SMILES | COCCOCCc1nc(C)c(C)c(Cl)n1 |
| InChI | InChI=1S/C11H17ClN2O2/c1-8-9(2)13-10(14-11(8)12)4-5-16-7-6-15-3/h4-7H2,1-3H3 |
| InChIKey | YJVGFZPQMJQVDU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|