C7H8Cl2N2O — CID 63612316
4,6-dichloro-2-(methoxymethyl)-5-methylpyrimidine (PubChem CID 63612316) has the molecular formula C7H8Cl2N2O and a molecular weight of 207.06 g/mol. Its IUPAC name is 4,6-dichloro-2-(methoxymethyl)-5-methylpyrimidine.
| Compound Name | 4,6-dichloro-2-(methoxymethyl)-5-methylpyrimidine |
|---|---|
| PubChem CID | 63612316 |
| Molecular Formula | C7H8Cl2N2O |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 4,6-dichloro-2-(methoxymethyl)-5-methylpyrimidine |
| SMILES | COCc1nc(Cl)c(C)c(Cl)n1 |
| InChI | InChI=1S/C7H8Cl2N2O/c1-4-6(8)10-5(3-12-2)11-7(4)9/h3H2,1-2H3 |
| InChIKey | DMZTVAGLXPYOLY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |