C7H8Cl2N2S — CID 174159301
4,6-dichloro-2-ethylsulfanyl-5-methylpyrimidine (PubChem CID 174159301) has the molecular formula C7H8Cl2N2S and a molecular weight of 223.13 g/mol. Its IUPAC name is 4,6-dichloro-2-ethylsulfanyl-5-methylpyrimidine.
| Compound Name | 4,6-dichloro-2-ethylsulfanyl-5-methylpyrimidine |
|---|---|
| PubChem CID | 174159301 |
| Molecular Formula | C7H8Cl2N2S |
| Molecular Weight | 223.13 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 4,6-dichloro-2-ethylsulfanyl-5-methylpyrimidine |
| SMILES | CCSc1nc(Cl)c(C)c(Cl)n1 |
| InChI | InChI=1S/C7H8Cl2N2S/c1-3-12-7-10-5(8)4(2)6(9)11-7/h3H2,1-2H3 |
| InChIKey | IPDKNKQDIXIDSK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |