C6H6Cl2N2S — CID 122575658
(4,6-dichloro-5-methylpyrimidin-2-yl)methanethiol (PubChem CID 122575658) has the molecular formula C6H6Cl2N2S and a molecular weight of 209.10 g/mol. Its IUPAC name is (4,6-dichloro-5-methylpyrimidin-2-yl)methanethiol.
| Compound Name | (4,6-dichloro-5-methylpyrimidin-2-yl)methanethiol |
|---|---|
| PubChem CID | 122575658 |
| Molecular Formula | C6H6Cl2N2S |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | (4,6-dichloro-5-methylpyrimidin-2-yl)methanethiol |
| SMILES | Cc1c(Cl)nc(CS)nc1Cl |
| InChI | InChI=1S/C6H6Cl2N2S/c1-3-5(7)9-4(2-11)10-6(3)8/h11H,2H2,1H3 |
| InChIKey | XDCRWNINLGEGSW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|