C6H8ClN3S — CID 122575657
(4-amino-6-chloro-5-methylpyrimidin-2-yl)methanethiol (PubChem CID 122575657) has the molecular formula C6H8ClN3S and a molecular weight of 189.67 g/mol. Its IUPAC name is (4-amino-6-chloro-5-methylpyrimidin-2-yl)methanethiol.
| Compound Name | (4-amino-6-chloro-5-methylpyrimidin-2-yl)methanethiol |
|---|---|
| PubChem CID | 122575657 |
| Molecular Formula | C6H8ClN3S |
| Molecular Weight | 189.67 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | (4-amino-6-chloro-5-methylpyrimidin-2-yl)methanethiol |
| SMILES | Cc1c(N)nc(CS)nc1Cl |
| InChI | InChI=1S/C6H8ClN3S/c1-3-5(7)9-4(2-11)10-6(3)8/h11H,2H2,1H3,(H2,8,9,10) |
| InChIKey | FUMBLEAJRIIXPD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|