C10H14Cl2N2 — CID 63892135
4,6-dichloro-2-(2,2-dimethylpropyl)-5-methylpyrimidine (PubChem CID 63892135) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is 4,6-dichloro-2-(2,2-dimethylpropyl)-5-methylpyrimidine.
| Compound Name | 4,6-dichloro-2-(2,2-dimethylpropyl)-5-methylpyrimidine |
|---|---|
| PubChem CID | 63892135 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4,6-dichloro-2-(2,2-dimethylpropyl)-5-methylpyrimidine |
| SMILES | Cc1c(Cl)nc(CC(C)(C)C)nc1Cl |
| InChI | InChI=1S/C10H14Cl2N2/c1-6-8(11)13-7(14-9(6)12)5-10(2,3)4/h5H2,1-4H3 |
| InChIKey | QDQDHUCBWIGWSL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |