C11H17ClN2 — CID 63891277
4-chloro-2-(2,2-dimethylpropyl)-6-ethylpyrimidine (PubChem CID 63891277) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 4-chloro-2-(2,2-dimethylpropyl)-6-ethylpyrimidine.
| Compound Name | 4-chloro-2-(2,2-dimethylpropyl)-6-ethylpyrimidine |
|---|---|
| PubChem CID | 63891277 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 4-chloro-2-(2,2-dimethylpropyl)-6-ethylpyrimidine |
| SMILES | CCc1cc(Cl)nc(CC(C)(C)C)n1 |
| InChI | InChI=1S/C11H17ClN2/c1-5-8-6-9(12)14-10(13-8)7-11(2,3)4/h6H,5,7H2,1-4H3 |
| InChIKey | KKAVXYKUWDTIID-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |