C7H5Cl2F3N2 — CID 130552298
4-chloro-6-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine (PubChem CID 130552298) has the molecular formula C7H5Cl2F3N2 and a molecular weight of 245.03 g/mol. Its IUPAC name is 4-chloro-6-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine.
| Compound Name | 4-chloro-6-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 130552298 |
| Molecular Formula | C7H5Cl2F3N2 |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | 4-chloro-6-(chloromethyl)-2-(2,2,2-trifluoroethyl)pyrimidine |
| SMILES | FC(F)(F)Cc1nc(Cl)cc(CCl)n1 |
| InChI | InChI=1S/C7H5Cl2F3N2/c8-3-4-1-5(9)14-6(13-4)2-7(10,11)12/h1H,2-3H2 |
| InChIKey | QRTBUDDFRBZGJC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|