C13H15ClF4N2O — CID 103473601
4-chloro-6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine (PubChem CID 103473601) has the molecular formula C13H15ClF4N2O and a molecular weight of 326.72 g/mol. Its IUPAC name is 4-chloro-6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine.
| Compound Name | 4-chloro-6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103473601 |
| Molecular Formula | C13H15ClF4N2O |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 4-chloro-6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine |
| SMILES | FC(F)C(F)(F)COCc1nc(Cl)cc(C2CCCC2)n1 |
| InChI | InChI=1S/C13H15ClF4N2O/c14-10-5-9(8-3-1-2-4-8)19-11(20-10)6-21-7-13(17,18)12(15)16/h5,8,12H,1-4,6-7H2 |
| InChIKey | KOGLUOGTDHBCOO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|