C13H16F4N2O — CID 106907736
N-[[6-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]methyl]cyclopropanamine (PubChem CID 106907736) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is N-[[6-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[6-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106907736 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[[6-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]methyl]cyclopropanamine |
| SMILES | FC(F)C(F)(F)COCc1cccc(CNC2CC2)n1 |
| InChI | InChI=1S/C13H16F4N2O/c14-12(15)13(16,17)8-20-7-11-3-1-2-10(19-11)6-18-9-4-5-9/h1-3,9,12,18H,4-8H2 |
| InChIKey | GNYOTBACGDFWHD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|