C11H13F4N3O — CID 107381478
N-[[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]cyclopropanamine (PubChem CID 107381478) has the molecular formula C11H13F4N3O and a molecular weight of 279.24 g/mol. Its IUPAC name is N-[[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107381478 |
| Molecular Formula | C11H13F4N3O |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-[[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]cyclopropanamine |
| SMILES | FC(F)C(F)(F)COc1cnc(CNC2CC2)cn1 |
| InChI | InChI=1S/C11H13F4N3O/c12-10(13)11(14,15)6-19-9-5-17-8(4-18-9)3-16-7-1-2-7/h4-5,7,10,16H,1-3,6H2 |
| InChIKey | UKNPOAFGOSKQDX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|