C10H13F4N3O — CID 66449615
N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]ethanamine (PubChem CID 66449615) has the molecular formula C10H13F4N3O and a molecular weight of 267.23 g/mol. Its IUPAC name is N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]ethanamine.
| Compound Name | N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66449615 |
| Molecular Formula | C10H13F4N3O |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[[6-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cncc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H13F4N3O/c1-2-15-3-7-4-16-5-8(17-7)18-6-10(13,14)9(11)12/h4-5,9,15H,2-3,6H2,1H3 |
| InChIKey | LFDGQSKBSPASJM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|