C8H10F4N4O — CID 103061744
[5-(2,2,3,3-tetrafluoropropoxymethyl)pyrazin-2-yl]hydrazine (PubChem CID 103061744) has the molecular formula C8H10F4N4O and a molecular weight of 254.19 g/mol. Its IUPAC name is [5-(2,2,3,3-tetrafluoropropoxymethyl)pyrazin-2-yl]hydrazine.
| Compound Name | [5-(2,2,3,3-tetrafluoropropoxymethyl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103061744 |
| Molecular Formula | C8H10F4N4O |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [5-(2,2,3,3-tetrafluoropropoxymethyl)pyrazin-2-yl]hydrazine |
| SMILES | NNc1cnc(COCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C8H10F4N4O/c9-7(10)8(11,12)4-17-3-5-1-15-6(16-13)2-14-5/h1-2,7H,3-4,13H2,(H,15,16) |
| InChIKey | RYBVCBUULUNFAU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|