C14H14F4N2O4 — CID 120977260
2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120977260) has the molecular formula C14H14F4N2O4 and a molecular weight of 350.27 g/mol. Its IUPAC name is 2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120977260 |
| Molecular Formula | C14H14F4N2O4 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)Nc1ccc(OCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C14H14F4N2O4/c15-13(16)14(17,18)6-24-10-4-1-7(5-19-10)20-11(21)8-2-3-9(8)12(22)23/h1,4-5,8-9,13H,2-3,6H2,(H,20,21)(H,22,23) |
| InChIKey | BXLSRXWIJMTLNE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|