C16H18F4N2O4 — CID 122113684
6-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidine-3-carboxylic acid (PubChem CID 122113684) has the molecular formula C16H18F4N2O4 and a molecular weight of 378.32 g/mol. Its IUPAC name is 6-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | 6-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113684 |
| Molecular Formula | C16H18F4N2O4 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 6-methyl-1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1C(=O)c1ccc(OCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C16H18F4N2O4/c1-9-2-3-11(14(24)25)7-22(9)13(23)10-4-5-12(21-6-10)26-8-16(19,20)15(17)18/h4-6,9,11,15H,2-3,7-8H2,1H3,(H,24,25) |
| InChIKey | HTHOWJJDRHLGRJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|