C16H18F4N2O4 — CID 120515566
2-[1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidin-4-yl]acetic acid (PubChem CID 120515566) has the molecular formula C16H18F4N2O4 and a molecular weight of 378.32 g/mol. Its IUPAC name is 2-[1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 120515566 |
| Molecular Formula | C16H18F4N2O4 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[1-[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)c2ccc(OCC(F)(F)C(F)F)nc2)CC1 |
| InChI | InChI=1S/C16H18F4N2O4/c17-15(18)16(19,20)9-26-12-2-1-11(8-21-12)14(25)22-5-3-10(4-6-22)7-13(23)24/h1-2,8,10,15H,3-7,9H2,(H,23,24) |
| InChIKey | SQNIUZXZRMEVCL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|