C16H19N3O — CID 107381795
N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]cyclopropanamine (PubChem CID 107381795) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107381795 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1cc(C)cc(Oc2cnc(CNC3CC3)cn2)c1 |
| InChI | InChI=1S/C16H19N3O/c1-11-5-12(2)7-15(6-11)20-16-10-18-14(9-19-16)8-17-13-3-4-13/h5-7,9-10,13,17H,3-4,8H2,1-2H3 |
| InChIKey | QZGBUTRUVLGWJP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |