C16H21N3O — CID 107381797
N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]propan-2-amine (PubChem CID 107381797) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107381797 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[[5-(3,5-dimethylphenoxy)pyrazin-2-yl]methyl]propan-2-amine |
| SMILES | Cc1cc(C)cc(Oc2cnc(CNC(C)C)cn2)c1 |
| InChI | InChI=1S/C16H21N3O/c1-11(2)17-8-14-9-19-16(10-18-14)20-15-6-12(3)5-13(4)7-15/h5-7,9-11,17H,8H2,1-4H3 |
| InChIKey | XOQYKMHAZQCVHK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |