C14H14Cl3N3O — CID 107381657
N-[[5-(2,4,5-trichlorophenoxy)pyrazin-2-yl]methyl]propan-2-amine (PubChem CID 107381657) has the molecular formula C14H14Cl3N3O and a molecular weight of 346.65 g/mol. Its IUPAC name is N-[[5-(2,4,5-trichlorophenoxy)pyrazin-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(2,4,5-trichlorophenoxy)pyrazin-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107381657 |
| Molecular Formula | C14H14Cl3N3O |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | N-[[5-(2,4,5-trichlorophenoxy)pyrazin-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cnc(Oc2cc(Cl)c(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C14H14Cl3N3O/c1-8(2)18-5-9-6-20-14(7-19-9)21-13-4-11(16)10(15)3-12(13)17/h3-4,6-8,18H,5H2,1-2H3 |
| InChIKey | QGJLLZMSTCIDGO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|