C14H14BrCl2N3O — CID 107660793
N-[[6-(4-bromo-2,5-dichlorophenoxy)pyridazin-3-yl]methyl]propan-2-amine (PubChem CID 107660793) has the molecular formula C14H14BrCl2N3O and a molecular weight of 391.10 g/mol. Its IUPAC name is N-[[6-(4-bromo-2,5-dichlorophenoxy)pyridazin-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[6-(4-bromo-2,5-dichlorophenoxy)pyridazin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107660793 |
| Molecular Formula | C14H14BrCl2N3O |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | N-[[6-(4-bromo-2,5-dichlorophenoxy)pyridazin-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(Oc2cc(Cl)c(Br)cc2Cl)nn1 |
| InChI | InChI=1S/C14H14BrCl2N3O/c1-8(2)18-7-9-3-4-14(20-19-9)21-13-6-11(16)10(15)5-12(13)17/h3-6,8,18H,7H2,1-2H3 |
| InChIKey | WHZXLWMQESNEKP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|