C16H18N2O — CID 106908050
N-[[6-(phenoxymethyl)-2-pyridinyl]methyl]cyclopropanamine (PubChem CID 106908050) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is N-[[6-(phenoxymethyl)-2-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[6-(phenoxymethyl)-2-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106908050 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[[6-(phenoxymethyl)-2-pyridinyl]methyl]cyclopropanamine |
| SMILES | c1ccc(OCc2cccc(CNC3CC3)n2)cc1 |
| InChI | InChI=1S/C16H18N2O/c1-2-7-16(8-3-1)19-12-15-6-4-5-14(18-15)11-17-13-9-10-13/h1-8,13,17H,9-12H2 |
| InChIKey | MDCPBCGSJXJNHX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |