C13H19F4N3O — CID 103476559
2-methyl-N-[[2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-yl]methyl]propan-1-amine (PubChem CID 103476559) has the molecular formula C13H19F4N3O and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-methyl-N-[[2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103476559 |
| Molecular Formula | C13H19F4N3O |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-methyl-N-[[2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidin-4-yl]methyl]propan-1-amine |
| SMILES | CC(C)CNCc1ccnc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C13H19F4N3O/c1-9(2)5-18-6-10-3-4-19-11(20-10)7-21-8-13(16,17)12(14)15/h3-4,9,12,18H,5-8H2,1-2H3 |
| InChIKey | FTCAZALTEAASAB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|