C10H12F4N4O2 — CID 103477251
4-amino-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxamide (PubChem CID 103477251) has the molecular formula C10H12F4N4O2 and a molecular weight of 296.22 g/mol. Its IUPAC name is 4-amino-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 103477251 |
| Molecular Formula | C10H12F4N4O2 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-amino-6-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)pyrimidine-5-carboxamide |
| SMILES | Cc1nc(COCC(F)(F)C(F)F)nc(N)c1C(N)=O |
| InChI | InChI=1S/C10H12F4N4O2/c1-4-6(8(16)19)7(15)18-5(17-4)2-20-3-10(13,14)9(11)12/h9H,2-3H2,1H3,(H2,16,19)(H2,15,17,18) |
| InChIKey | LXRXQPRVLTXOSL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|