C10H12F4N2O2 — CID 136967812
4,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136967812) has the molecular formula C10H12F4N2O2 and a molecular weight of 268.21 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136967812 |
| Molecular Formula | C10H12F4N2O2 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4,5-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1C |
| InChI | InChI=1S/C10H12F4N2O2/c1-5-6(2)15-7(16-8(5)17)3-18-4-10(13,14)9(11)12/h9H,3-4H2,1-2H3,(H,15,16,17) |
| InChIKey | RNNFWKPXLFZNON-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|