C11H14F4N2O2 — CID 136890411
5-ethyl-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890411) has the molecular formula C11H14F4N2O2 and a molecular weight of 282.24 g/mol. Its IUPAC name is 5-ethyl-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-ethyl-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890411 |
| Molecular Formula | C11H14F4N2O2 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-ethyl-4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CCc1c(C)nc(COCC(F)(F)C(F)F)[nH]c1=O |
| InChI | InChI=1S/C11H14F4N2O2/c1-3-7-6(2)16-8(17-9(7)18)4-19-5-11(14,15)10(12)13/h10H,3-5H2,1-2H3,(H,16,17,18) |
| InChIKey | FXSZFTHTHYZXQZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|