C12H16F2N2O4 — CID 136842490
3-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoic acid (PubChem CID 136842490) has the molecular formula C12H16F2N2O4 and a molecular weight of 290.27 g/mol. Its IUPAC name is 3-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoic acid.
| Compound Name | 3-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 136842490 |
| Molecular Formula | C12H16F2N2O4 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-[2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoic acid |
| SMILES | Cc1nc(CCOCC(F)F)[nH]c(=O)c1CCC(=O)O |
| InChI | InChI=1S/C12H16F2N2O4/c1-7-8(2-3-11(17)18)12(19)16-10(15-7)4-5-20-6-9(13)14/h9H,2-6H2,1H3,(H,17,18)(H,15,16,19) |
| InChIKey | YSRCAKGCIRTRGM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|