C11H16Cl2N2 — CID 79404356
2-butyl-4,6-dichloro-5-propylpyrimidine (PubChem CID 79404356) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 2-butyl-4,6-dichloro-5-propylpyrimidine.
| Compound Name | 2-butyl-4,6-dichloro-5-propylpyrimidine |
|---|---|
| PubChem CID | 79404356 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-butyl-4,6-dichloro-5-propylpyrimidine |
| SMILES | CCCCc1nc(Cl)c(CCC)c(Cl)n1 |
| InChI | InChI=1S/C11H16Cl2N2/c1-3-5-7-9-14-10(12)8(6-4-2)11(13)15-9/h3-7H2,1-2H3 |
| InChIKey | DGSFLQZYCIINLC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |