C8H10Br2ClN3 — CID 3070103
6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-amine (PubChem CID 3070103) has the molecular formula C8H10Br2ClN3 and a molecular weight of 343.45 g/mol. Its IUPAC name is 6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 3070103 |
| Molecular Formula | C8H10Br2ClN3 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 340.89 |
| IUPAC Name | 6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(N)c(CC(Br)CBr)c(Cl)n1 |
| InChI | InChI=1S/C8H10Br2ClN3/c1-4-13-7(11)6(8(12)14-4)2-5(10)3-9/h5H,2-3H2,1H3,(H2,12,13,14) |
| InChIKey | NCWOCIBSHJRJAJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|