C18H20ClNO7S — CID 58403519
2-[2-chloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonylphenoxy]-N-methylacetamide (PubChem CID 58403519) has the molecular formula C18H20ClNO7S and a molecular weight of 429.88 g/mol. Its IUPAC name is 2-[2-chloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonylphenoxy]-N-methylacetamide.
| Compound Name | 2-[2-chloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonylphenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 58403519 |
| Molecular Formula | C18H20ClNO7S |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[2-chloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonylphenoxy]-N-methylacetamide |
| SMILES | CCS(=O)(=O)c1ccc(C(O)=C2C(=O)CCCC2=O)c(Cl)c1OCC(=O)NC |
| InChI | InChI=1S/C18H20ClNO7S/c1-3-28(25,26)13-8-7-10(16(19)18(13)27-9-14(23)20-2)17(24)15-11(21)5-4-6-12(15)22/h7-8,24H,3-6,9H2,1-2H3,(H,20,23) |
| InChIKey | BAPQRSXHEKRHMY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|