C20H22F3NO8S — CID 123263052
2-[3-(2,6-dioxocyclohexanecarbonyl)-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-methoxy-N-methylacetamide (PubChem CID 123263052) has the molecular formula C20H22F3NO8S and a molecular weight of 493.46 g/mol. Its IUPAC name is 2-[3-(2,6-dioxocyclohexanecarbonyl)-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[3-(2,6-dioxocyclohexanecarbonyl)-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 123263052 |
| Molecular Formula | C20H22F3NO8S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-[3-(2,6-dioxocyclohexanecarbonyl)-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-methoxy-N-methylacetamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(C(F)(F)F)c1OCC(=O)N(C)OC |
| InChI | InChI=1S/C20H22F3NO8S/c1-4-33(29,30)14-9-8-11(18(28)16-12(25)6-5-7-13(16)26)17(20(21,22)23)19(14)32-10-15(27)24(2)31-3/h8-9,16H,4-7,10H2,1-3H3 |
| InChIKey | WVQVYKWLSJTPPS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|