C18H18ClNO6S2 — CID 72642182
2-[4-chloro-2-(2-methoxyiminoethylsulfanyl)-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione (PubChem CID 72642182) has the molecular formula C18H18ClNO6S2 and a molecular weight of 443.93 g/mol. Its IUPAC name is 2-[4-chloro-2-(2-methoxyiminoethylsulfanyl)-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 2-[4-chloro-2-(2-methoxyiminoethylsulfanyl)-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 72642182 |
| Molecular Formula | C18H18ClNO6S2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 2-[4-chloro-2-(2-methoxyiminoethylsulfanyl)-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione |
| SMILES | CON=CCSC1Cc2c(ccc(C(=O)C3C(=O)CCCC3=O)c2Cl)S1(=O)=O |
| InChI | InChI=1S/C18H18ClNO6S2/c1-26-20-7-8-27-15-9-11-14(28(15,24)25)6-5-10(17(11)19)18(23)16-12(21)3-2-4-13(16)22/h5-7,15-16H,2-4,8-9H2,1H3 |
| InChIKey | BGNXMCCNFNNIKS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|