C18H18ClO6S- — CID 174523869
[3-chloro-2-(cyclopropylmethoxy)-4-(2,6-dioxocyclohexanecarbonyl)phenyl]methanesulfinate (PubChem CID 174523869) has the molecular formula C18H18ClO6S- and a molecular weight of 397.86 g/mol. Its IUPAC name is [3-chloro-2-(cyclopropylmethoxy)-4-(2,6-dioxocyclohexanecarbonyl)phenyl]methanesulfinate.
| Compound Name | [3-chloro-2-(cyclopropylmethoxy)-4-(2,6-dioxocyclohexanecarbonyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174523869 |
| Molecular Formula | C18H18ClO6S- |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [3-chloro-2-(cyclopropylmethoxy)-4-(2,6-dioxocyclohexanecarbonyl)phenyl]methanesulfinate |
| SMILES | O=C1CCCC(=O)C1C(=O)c1ccc(CS(=O)[O-])c(OCC2CC2)c1Cl |
| InChI | InChI=1S/C18H19ClO6S/c19-16-12(17(22)15-13(20)2-1-3-14(15)21)7-6-11(9-26(23)24)18(16)25-8-10-4-5-10/h6-7,10,15H,1-5,8-9H2,(H,23,24)/p-1 |
| InChIKey | REYAEARXSYDPQH-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|