C17H15F3O3S2 — CID 91156665
2-[2-methylsulfanyl-4-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione (PubChem CID 91156665) has the molecular formula C17H15F3O3S2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[2-methylsulfanyl-4-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-methylsulfanyl-4-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 91156665 |
| Molecular Formula | C17H15F3O3S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-[2-methylsulfanyl-4-(trifluoromethyl)-2,3-dihydro-1-benzothiophene-5-carbonyl]cyclohexane-1,3-dione |
| SMILES | CSC1Cc2c(ccc(C(=O)C3C(=O)CCCC3=O)c2C(F)(F)F)S1 |
| InChI | InChI=1S/C17H15F3O3S2/c1-24-13-7-9-12(25-13)6-5-8(15(9)17(18,19)20)16(23)14-10(21)3-2-4-11(14)22/h5-6,13-14H,2-4,7H2,1H3 |
| InChIKey | HYBJFRBOMDNWRD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|