C17H10F6N2O3 — CID 87069136
2-[2,7-bis(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione (PubChem CID 87069136) has the molecular formula C17H10F6N2O3 and a molecular weight of 404.27 g/mol. Its IUPAC name is 2-[2,7-bis(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2,7-bis(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 87069136 |
| Molecular Formula | C17H10F6N2O3 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-[2,7-bis(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1C(=O)c1cc2ccc(C(F)(F)F)nc2nc1C(F)(F)F |
| InChI | InChI=1S/C17H10F6N2O3/c18-16(19,20)11-5-4-7-6-8(14(17(21,22)23)25-15(7)24-11)13(28)12-9(26)2-1-3-10(12)27/h4-6,12H,1-3H2 |
| InChIKey | LPMOTOQRIXAUDY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|