C22H21F3N2O5 — CID 66601995
6-[7-ethoxy-2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 66601995) has the molecular formula C22H21F3N2O5 and a molecular weight of 450.41 g/mol. Its IUPAC name is 6-[7-ethoxy-2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[7-ethoxy-2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 66601995 |
| Molecular Formula | C22H21F3N2O5 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 6-[7-ethoxy-2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CCOc1ccc2cc(C(=O)C3C(=O)C(C)(C)C(=O)C(C)(C)C3=O)c(C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C22H21F3N2O5/c1-6-32-12-8-7-10-9-11(15(22(23,24)25)27-18(10)26-12)14(28)13-16(29)20(2,3)19(31)21(4,5)17(13)30/h7-9,13H,6H2,1-5H3 |
| InChIKey | NWCRAARWKVKHJE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|