C20H23F2NO6 — CID 163703681
5-(1,1-difluoropropyl)-N-hydroxy-2-(3,3,5,5-tetramethyl-2,4,6-trioxocyclohexanecarbonyl)benzeneamine oxide (PubChem CID 163703681) has the molecular formula C20H23F2NO6 and a molecular weight of 411.40 g/mol. Its IUPAC name is 5-(1,1-difluoropropyl)-N-hydroxy-2-(3,3,5,5-tetramethyl-2,4,6-trioxocyclohexanecarbonyl)benzeneamine oxide.
| Compound Name | 5-(1,1-difluoropropyl)-N-hydroxy-2-(3,3,5,5-tetramethyl-2,4,6-trioxocyclohexanecarbonyl)benzeneamine oxide |
|---|---|
| PubChem CID | 163703681 |
| Molecular Formula | C20H23F2NO6 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 5-(1,1-difluoropropyl)-N-hydroxy-2-(3,3,5,5-tetramethyl-2,4,6-trioxocyclohexanecarbonyl)benzeneamine oxide |
| SMILES | CCC(F)(F)c1ccc(C(=O)C2C(=O)C(C)(C)C(=O)C(C)(C)C2=O)c([NH+]([O-])O)c1 |
| InChI | InChI=1S/C20H23F2NO6/c1-6-20(21,22)10-7-8-11(12(9-10)23(28)29)14(24)13-15(25)18(2,3)17(27)19(4,5)16(13)26/h7-9,13,23,28H,6H2,1-5H3 |
| InChIKey | KDEZSDSUQMAYJM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|