C17H14F3NO7S — CID 23051935
7-[2-nitro-4-(trifluoromethyl)benzoyl]-1,1-dioxo-1λ6-thiaspiro[4.5]decane-6,8-dione (PubChem CID 23051935) has the molecular formula C17H14F3NO7S and a molecular weight of 433.36 g/mol. Its IUPAC name is 7-[2-nitro-4-(trifluoromethyl)benzoyl]-1,1-dioxo-1λ6-thiaspiro[4.5]decane-6,8-dione.
| Compound Name | 7-[2-nitro-4-(trifluoromethyl)benzoyl]-1,1-dioxo-1λ6-thiaspiro[4.5]decane-6,8-dione |
|---|---|
| PubChem CID | 23051935 |
| Molecular Formula | C17H14F3NO7S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 7-[2-nitro-4-(trifluoromethyl)benzoyl]-1,1-dioxo-1λ6-thiaspiro[4.5]decane-6,8-dione |
| SMILES | O=C1CCC2(CCCS2(=O)=O)C(=O)C1C(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14F3NO7S/c18-17(19,20)9-2-3-10(11(8-9)21(25)26)14(23)13-12(22)4-6-16(15(13)24)5-1-7-29(16,27)28/h2-3,8,13H,1,4-7H2 |
| InChIKey | QTRPNOAMROKRFG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 128.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|