C17H14F3NO5 — CID 177357156
8-[2-nitro-4-(trifluoromethyl)benzoyl]spiro[3.5]nonane-7,9-dione (PubChem CID 177357156) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is 8-[2-nitro-4-(trifluoromethyl)benzoyl]spiro[3.5]nonane-7,9-dione.
| Compound Name | 8-[2-nitro-4-(trifluoromethyl)benzoyl]spiro[3.5]nonane-7,9-dione |
|---|---|
| PubChem CID | 177357156 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 8-[2-nitro-4-(trifluoromethyl)benzoyl]spiro[3.5]nonane-7,9-dione |
| SMILES | O=C1CCC2(CCC2)C(=O)C1C(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14F3NO5/c18-17(19,20)9-2-3-10(11(8-9)21(25)26)14(23)13-12(22)4-7-16(15(13)24)5-1-6-16/h2-3,8,13H,1,4-7H2 |
| InChIKey | BVBUBIUDKQBUDM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|