C18H18F3NO5 — CID 147896778
6-[2-(hydroxyamino)-4-(trifluoromethyl)benzoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 147896778) has the molecular formula C18H18F3NO5 and a molecular weight of 385.34 g/mol. Its IUPAC name is 6-[2-(hydroxyamino)-4-(trifluoromethyl)benzoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[2-(hydroxyamino)-4-(trifluoromethyl)benzoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 147896778 |
| Molecular Formula | C18H18F3NO5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 6-[2-(hydroxyamino)-4-(trifluoromethyl)benzoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CC1(C)C(=O)C(C(=O)c2ccc(C(F)(F)F)cc2NO)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C18H18F3NO5/c1-16(2)13(24)11(14(25)17(3,4)15(16)26)12(23)9-6-5-8(18(19,20)21)7-10(9)22-27/h5-7,11,22,27H,1-4H3 |
| InChIKey | IDLNWMLSCIHGSH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|