C17H17F3O2S — CID 19911138
4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione (PubChem CID 19911138) has the molecular formula C17H17F3O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione.
| Compound Name | 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 19911138 |
| Molecular Formula | C17H17F3O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(=S)C1C(=O)CCC(C)(C)C1=O |
| InChI | InChI=1S/C17H17F3O2S/c1-9-8-10(17(18,19)20)4-5-11(9)14(23)13-12(21)6-7-16(2,3)15(13)22/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | PERQIBONMYKWPQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|