About 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione
4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione (PubChem CID 19911138) has the molecular formula C17H17F3O2S
and a molecular weight of 342.38 g/mol. Its IUPAC name is 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione |
| PubChem CID | 19911138 |
| Molecular Formula | C17H17F3O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(=S)C1C(=O)CCC(C)(C)C1=O |
| InChI | InChI=1S/C17H17F3O2S/c1-9-8-10(17(18,19)20)4-5-11(9)14(23)13-12(21)6-7-16(2,3)15(13)22/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | PERQIBONMYKWPQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione?
The IUPAC name of 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione (CID 19911138) is 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione.
What is the SMILES notation for 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione?
The canonical SMILES for 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione is Cc1cc(C(F)(F)F)ccc1C(=S)C1C(=O)CCC(C)(C)C1=O.
What is the InChIKey of 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione?
The InChIKey is PERQIBONMYKWPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3O2S/c1-9-8-10(17(18,19)20)4-5-11(9)14(23)13-12(21)6-7-16(2,3)15(13)22/h4-5,8,13H,6-7H2,1-3H3.
What are the key properties of 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione?
4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione has a molecular weight of 342.38 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-[2-methyl-4-(trifluoromethyl)benzenecarbothioyl]cyclohexane-1,3-dione is sourced from PubChem (CID 19911138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).