C15H18F3NO2 — CID 102756941
[4-(aminomethyl)oxan-4-yl]-[2-methyl-4-(trifluoromethyl)phenyl]methanone (PubChem CID 102756941) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is [4-(aminomethyl)oxan-4-yl]-[2-methyl-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(aminomethyl)oxan-4-yl]-[2-methyl-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 102756941 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [4-(aminomethyl)oxan-4-yl]-[2-methyl-4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(=O)C1(CN)CCOCC1 |
| InChI | InChI=1S/C15H18F3NO2/c1-10-8-11(15(16,17)18)2-3-12(10)13(20)14(9-19)4-6-21-7-5-14/h2-3,8H,4-7,9,19H2,1H3 |
| InChIKey | CXULPASDPGQTDL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |